2-(2,4-dibromophenyl)-5-phenyl-1H-1,2,4-triazol-3-one structure
|
Common Name | 2-(2,4-dibromophenyl)-5-phenyl-1H-1,2,4-triazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 106538-35-6 | Molecular Weight | 395.04900 | |
| Density | 1.83g/cm3 | Boiling Point | 455ºC at 760 mmHg | |
| Molecular Formula | C14H9Br2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229ºC | |
| Name | 2-(2,4-dibromophenyl)-5-phenyl-1H-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.83g/cm3 |
|---|---|
| Boiling Point | 455ºC at 760 mmHg |
| Molecular Formula | C14H9Br2N3O |
| Molecular Weight | 395.04900 |
| Flash Point | 229ºC |
| Exact Mass | 392.91100 |
| PSA | 50.68000 |
| LogP | 3.75260 |
| Vapour Pressure | 1.82E-08mmHg at 25°C |
| Index of Refraction | 1.725 |
| InChIKey | XZPYNEVOOICIET-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2)nn1-c1ccc(Br)cc1Br |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS1676F17 |
| 2-(2,4-Dibrom-phenyl)-5-phenyl-1,2-dihydro-[1,2,4]triazol-3-on |
| 2-(2,4-Dibromo-phenyl)-5-phenyl-1,2-dihydro-[1,2,4]triazol-3-one |
| 3H-1,2,4-Triazol-3-one,2-(2,4-dibromophenyl)-1,2-dihydro-5-phenyl |