Dimethyl 2-iodoisophthalate structure
|
Common Name | Dimethyl 2-iodoisophthalate | ||
|---|---|---|---|---|
| CAS Number | 106589-18-8 | Molecular Weight | 320.081 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 321.8±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H9IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4±22.3 °C | |
| Name | dimethyl 2-iodobenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.8±22.0 °C at 760 mmHg |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.081 |
| Flash Point | 148.4±22.3 °C |
| Exact Mass | 319.954529 |
| PSA | 52.60000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | WBLBZWRGFUJZKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1I |
| HS Code | 2917399090 |
|---|
|
~87%
Dimethyl 2-iodo... CAS#:106589-18-8 |
| Literature: Tetrahedron Letters, , vol. 55, # 16 p. 2687 - 2690 |
|
~%
Dimethyl 2-iodo... CAS#:106589-18-8 |
| Literature: Journal of the American Chemical Society, , vol. 51, p. 3353 |
|
~%
Dimethyl 2-iodo... CAS#:106589-18-8 |
| Literature: Chemische Berichte, , vol. 44, p. 2301 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid, 2-iodo-, dimethyl ester |
| 2-Iodo-isophthalic acid dimethyl ester |
| Dimethyl 2-iodoisophthalate |
| 2-Jod-isophthalsaeure-dimethylester |
| 1,3-Benzenedicarboxylicacid,2-iodo-,1,3-dimethyl ester |