N-[2-(dimethylamino)ethyl]-2-methoxyacridine-4-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]-2-methoxyacridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 106626-69-1 | Molecular Weight | 323.38900 | |
| Density | 1.188g/cm3 | Boiling Point | 539.4ºC at 760mmHg | |
| Molecular Formula | C19H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280ºC | |
| Name | N-[2-(dimethylamino)ethyl]-2-methoxyacridine-4-carboxamide |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 539.4ºC at 760mmHg |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.38900 |
| Flash Point | 280ºC |
| Exact Mass | 323.16300 |
| PSA | 57.95000 |
| LogP | 3.26280 |
| Vapour Pressure | 1.05E-11mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | ASXJQFGUSLWIBV-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NCCN(C)C)c2nc3ccccc3cc2c1 |
|
~%
N-[2-(dimethyla... CAS#:106626-69-1 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Baguley, Bruce C.; Denny, William A. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 664 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |