2-chloro-N-[2-(dimethylamino)ethyl]acridine-4-carboxamide structure
|
Common Name | 2-chloro-N-[2-(dimethylamino)ethyl]acridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 106626-70-4 | Molecular Weight | 327.80800 | |
| Density | 1.261g/cm3 | Boiling Point | 535.4ºC at 760mmHg | |
| Molecular Formula | C18H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | 2-chloro-N-[2-(dimethylamino)ethyl]acridine-4-carboxamide |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 535.4ºC at 760mmHg |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.80800 |
| Flash Point | 277.6ºC |
| Exact Mass | 327.11400 |
| PSA | 48.72000 |
| LogP | 3.90760 |
| Vapour Pressure | 1.54E-11mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | QZUSPLMBYZALDE-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)c1cc(Cl)cc2cc3ccccc3nc12 |
|
~%
2-chloro-N-[2-(... CAS#:106626-70-4 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Baguley, Bruce C.; Denny, William A. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 664 - 669 |
|
~%
2-chloro-N-[2-(... CAS#:106626-70-4 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Baguley, Bruce C.; Denny, William A. Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 664 - 669 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |