N-[2-(dimethylamino)ethyl]-8-methylacridine-4-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]-8-methylacridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 106626-81-7 | Molecular Weight | 307.39000 | |
| Density | 1.163g/cm3 | Boiling Point | 554.4ºC at 760mmHg | |
| Molecular Formula | C19H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.1ºC | |
| Name | N-[2-(dimethylamino)ethyl]-8-methylacridine-4-carboxamide |
|---|
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 554.4ºC at 760mmHg |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.39000 |
| Flash Point | 289.1ºC |
| Exact Mass | 307.16800 |
| PSA | 48.72000 |
| LogP | 3.56260 |
| Vapour Pressure | 2.49E-12mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | WUCCTNZMKRRCCJ-UHFFFAOYSA-N |
| SMILES | Cc1cccc2nc3c(C(=O)NCCN(C)C)cccc3cc12 |
|
~%
N-[2-(dimethyla... CAS#:106626-81-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 4 p. 664 - 669 |
|
~%
N-[2-(dimethyla... CAS#:106626-81-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 4 p. 664 - 669 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |