Dimethylaminotri-N-Butyltin structure
|
Common Name | Dimethylaminotri-N-Butyltin | ||
|---|---|---|---|---|
| CAS Number | 1067-24-9 | Molecular Weight | 334.12000 | |
| Density | 1.08 g/cm3 | Boiling Point | 86ºC 0,1mm | |
| Molecular Formula | C14H33NSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115ºC | |
| Name | dimethylaminotri-n-butyltin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08 g/cm3 |
|---|---|
| Boiling Point | 86ºC 0,1mm |
| Molecular Formula | C14H33NSn |
| Molecular Weight | 334.12000 |
| Flash Point | 115ºC |
| Exact Mass | 335.16300 |
| PSA | 3.24000 |
| LogP | 4.89380 |
| Index of Refraction | 1.4737 |
| InChIKey | OWTXIZLJXVEGMT-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)N(C)C |
| RIDADR | UN 1760 |
|---|---|
| HS Code | 2931900090 |
|
~%
Dimethylaminotr... CAS#:1067-24-9 |
| Literature: Journal of Organometallic Chemistry, , vol. 44, p. C 43 - C 45 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tributylcyanotin |
| tris(n-butyl)tin cyanide |
| Tin,tributylcyano |
| Tri-n-butyltin cyanide |
| Stannanecarbonitrile,tributyl |
| dimethylamino tributyltin |
| tributylstannyl dimethylamide |
| (dimethylamino)tributylstannane |
| tributylstannyl cyanide |
| dimetylamino-tri-n-butyltin |
| Tributylstannanecarbonitrile |
| Tributyltin cyanide |
| 1,1,1-tributyl-N,N-dimethylstannanamine |
| (N,N-dimethylamino)tributyltin |