Dobupride structure
|
Common Name | Dobupride | ||
|---|---|---|---|---|
| CAS Number | 106707-51-1 | Molecular Weight | 411.92300 | |
| Density | 1.26g/cm3 | Boiling Point | 544.5ºC at 760 mmHg | |
| Molecular Formula | C20H30ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.1ºC | |
Use of DobuprideDobupride is a novel gastroprokinetic drug. |
| Name | 4-amino-2-butoxy-5-chloro-N-[1-(1,3-dioxolan-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Dobupride is a novel gastroprokinetic drug. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 544.5ºC at 760 mmHg |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.92300 |
| Flash Point | 283.1ºC |
| Exact Mass | 411.19200 |
| PSA | 89.54000 |
| LogP | 3.76210 |
| Vapour Pressure | 6.51E-12mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | BTBFXLRQGPHRGT-UHFFFAOYSA-N |
| SMILES | CCCCOc1cc(N)c(Cl)cc1C(=O)NC1CCN(CC2OCCO2)CC1 |
| Storage condition | 2-8℃ |
| UNII-FW0Z2U7O23 |
| Dobupridum [Latin] |
| Dobuprida [Spanish] |
| Dobupridum |
| Dobuprida |
| Dobupride |