1-benzyl-4,4-dimethylpiperidine-2,6-dione structure
|
Common Name | 1-benzyl-4,4-dimethylpiperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 106754-11-4 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 37.38000 |
| LogP | 2.29970 |
| InChIKey | ZQADGHDZWLYXBI-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)N(Cc2ccccc2)C(=O)C1 |
|
~91%
1-benzyl-4,4-di... CAS#:106754-11-4 |
| Literature: F. HOFFMANN-LA ROCHE AG; HENDRICKS, Robert Than; HERMANN, Johannes Cornelius; KONDRU, Rama K.; LOU, Yan; LYNCH, Stephen M.; OWENS, Timothy D.; SOTH, Michael; YEE, Calvin Wesley Patent: WO2011/144584 A1, 2011 ; Location in patent: Page/Page column 67-68 ; WO 2011/144584 A1 |
|
~%
1-benzyl-4,4-di... CAS#:106754-11-4 |
| Literature: Paden; Adkins Journal of the American Chemical Society, 1936 , vol. 58, p. 2493 |
| 1-Benzyl-4,4-dimethyl-piperidin-2,6-dion |
| HMS2613P23 |
| 1-benzyl-4,4-dimethyl-piperidine-2,6-dione |
| 1-benzyl-4,4-dimethyl-2,6-piperidinedione |