(3-amino-4-chlorophenyl)-(4-methylphenyl)methanone structure
|
Common Name | (3-amino-4-chlorophenyl)-(4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 106841-04-7 | Molecular Weight | 245.70400 | |
| Density | 1.24g/cm3 | Boiling Point | 428.7ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | (3-amino-4-chlorophenyl)-(4-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 213.1ºC |
| Exact Mass | 245.06100 |
| PSA | 43.09000 |
| LogP | 4.04280 |
| Vapour Pressure | 1.48E-07mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | MXUQMGQNTODIEL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccc(Cl)c(N)c2)cc1 |
| HS Code | 2922399090 |
|---|
|
~%
(3-amino-4-chlo... CAS#:106841-04-7 |
| Literature: Graf et al. Helvetica Chimica Acta, 1959 , vol. 42, p. 1085,1086 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-amino-4-chloro-4'-methyl-benzophenone |
| 3-Amino-4-chlor-4'-methyl-benzophenon |