1-benzyl-2,4,5-tris(methylsulfanyl)imidazole structure
|
Common Name | 1-benzyl-2,4,5-tris(methylsulfanyl)imidazole | ||
|---|---|---|---|---|
| CAS Number | 106848-40-2 | Molecular Weight | 296.47500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-2,4,5-tris(methylsulfanyl)imidazole |
|---|
| Molecular Formula | C13H16N2S3 |
|---|---|
| Molecular Weight | 296.47500 |
| Exact Mass | 296.04800 |
| PSA | 93.72000 |
| LogP | 4.09710 |
| InChIKey | UXQURJPDPXEOTM-UHFFFAOYSA-N |
| SMILES | CSc1nc(SC)n(Cc2ccccc2)c1SC |
|
~64%
1-benzyl-2,4,5-... CAS#:106848-40-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1453 - 1456 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |