2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide
![2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide Structure](https://image.chemsrc.com/caspic/421/106910-71-8.png)
2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide structure
|
Common Name | 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide | ||
|---|---|---|---|---|
| CAS Number | 106910-71-8 | Molecular Weight | 290.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-[(2-Oxonaphthalen-1-ylidene)methylamino]benzamide, CAS 106910-71-8, with molecular formula C18H14N2O2 and molecular weight 290.31600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14N2O2 |
|---|---|
| Molecular Weight | 290.31600 |
| Exact Mass | 290.10600 |
| PSA | 73.18000 |
| LogP | 3.79160 |
| InChIKey | ACZOPDXPANCKJA-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccccc1N=Cc1c(O)ccc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity against human SIRT1 at 100 uM
Source: ChEMBL
Target: NAD-dependent protein deacetylase sirtuin-1
External Id: CHEMBL859800
|
|
Name: Inhibitory activity against recombinant yeast Sir2 at 100 uM
Source: ChEMBL
Target: NAD-dependent histone deacetylase SIR2
External Id: CHEMBL858724
|
|
Name: Inhibitory activity against human SIRT2
Source: ChEMBL
Target: NAD-dependent protein deacetylase sirtuin-2
External Id: CHEMBL859745
|
|
Name: Inhibitory activity against human SIRT2 at 100 uM
Source: ChEMBL
Target: NAD-dependent protein deacetylase sirtuin-2
External Id: CHEMBL859744
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: Molecular formula of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is C18H14N2O2. |
| Q: What is the English name of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: The English name of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide. |
| Q: What is the polar surface area (PSA) of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: Polar surface area (PSA) of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is 73.18000. |
| Q: What is the LogP of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: LogP of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is 3.79160. |
| Q: What are the upstream materials of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: Related upstream materials(CAS) of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide: 28144-70-9;708-06-5. |
| Q: What is the InChIKey of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: InChIKey of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is ACZOPDXPANCKJA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: CAS number of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is 106910-71-8. |
| Q: What is the SMILES notation of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: SMILES notation of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is NC(=O)c1ccccc1N=Cc1c(O)ccc2ccccc12. |
| Q: What is the Chinese name of 106910-71-8? |
| A: Chinese name of 106910-71-8 is 106910-71-8. |
| Q: What is the molecular weight of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide? |
| A: Molecular weight of 2-[(2-oxonaphthalen-1-ylidene)methylamino]benzamide is 290.31600. |