3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid
Modify Date: 2026-07-06 22:28:27
![3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/214/1069111-06-3.png)
3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid structure
|
Common Name | 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1069111-06-3 | Molecular Weight | 258.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N2O3 |
|---|---|
| Molecular Weight | 258.27 |
| InChIKey | JJFDKDQAHZWXRO-UHFFFAOYSA-N |
| SMILES | O=C(Cc1c(C(=O)O)[nH]c2ccccc12)NC1CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: InChIKey of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is JJFDKDQAHZWXRO-UHFFFAOYSA-N. |
| Q: What is the English name of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: The English name of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid. |
| Q: What is the SMILES notation of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: SMILES notation of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is O=C(Cc1c(C(=O)O)[nH]c2ccccc12)NC1CC1. |
| Q: What is the CAS number of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: CAS number of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is 1069111-06-3. |
| Q: What is the molecular weight of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: Molecular weight of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is 258.27. |
| Q: What is the molecular formula of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid? |
| A: Molecular formula of 3-[(cyclopropylcarbamoyl)methyl]-1H-indole-2-carboxylic acid is C14H14N2O3. |
| Q: What is the Chinese name of 1069111-06-3? |
| A: Chinese name of 1069111-06-3 is 1069111-06-3. |