Ast-487 structure
|
Common Name | Ast-487 | ||
|---|---|---|---|---|
| CAS Number | 1069112-48-6 | Molecular Weight | 529.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H30F3N7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ast-487 |
|---|
| Molecular Formula | C26H30F3N7O2 |
|---|---|
| Molecular Weight | 529.6 |
| InChIKey | ODPGGGTTYSGTGO-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC4=NC=NC(=C4)NC)C(F)(F)F |
|
Name: Human KIT proto-oncogene receptor tyrosine kinase (Type III RTKs: PDGFR, CSFR, Kit, F...
Source: IUPHAR-DB
Target: KIT proto-oncogene receptor tyrosine kinase (Type III RTKs: PDGFR, CSFR, Kit, FLT3 receptor family) [Homo sapiens]
External Id: 1805_Human
|
|
Name: Primary qHTS to identify gynecologic anti-cancer compounds using libraries of approve...
Source: NCGC
Target: N/A
External Id: OBG420
|
|
Name: Binding affinity to DLK (unknown origin) assessed as dissociation constant
Source: ChEMBL
Target: Protein delta homolog 1
External Id: CHEMBL5322599
|
|
Name: Cytochrome P450 family 3 subfamily A member 7 (CYP3A7) small molecule antagonists: lu...
Source: NCGC
External Id: CYP3A7681
|
|
Name: Primary qHTS for inhibitors of NSP2Pro chikungunya virus (CHIKV)
Source: NCGC
External Id: APP-Toga-CHIKV-nsp2-p
|
|
Name: Inhibition of human recombinant full-length MEK7 using JNK1 as substrate incubated fo...
Source: ChEMBL
Target: Dual specificity mitogen-activated protein kinase kinase 7
External Id: CHEMBL5260478
|
|
Name: Incucyte cell viability with human fibroblast
Source: ChEMBL
Target: Fibroblast
External Id: CHEMBL4725213
|
|
Name: Incucyte cell viability with HEK293T
Source: ChEMBL
Target: HEK-293T
External Id: CHEMBL4725212
|
|
Name: Inhibition of NEK9 (unknown origin) assessed as dissociation constant
Source: ChEMBL
Target: Serine/threonine-protein kinase Nek9
External Id: CHEMBL5252684
|