methyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-methylpropanoate
Modify Date: 2025-11-29 19:32:55
methyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-methylpropanoate structure
|
Common Name | methyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 1069115-22-5 | Molecular Weight | 317.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(2-bromo-4,5-dimethoxyphenyl)-2-methylpropanoate |
|---|
| Molecular Formula | C13H17BrO4 |
|---|---|
| Molecular Weight | 317.17600 |
| Exact Mass | 316.03100 |
| PSA | 44.76000 |
| LogP | 2.91690 |
| InChIKey | ZAUZPKPZTDDZKB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)c1cc(OC)c(OC)cc1Br |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |