4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine
Modify Date: 2026-07-04 10:27:19
4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 106912-96-3 | Molecular Weight | 281.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10Cl2N4 |
|---|---|
| Molecular Weight | 281.14 |
| InChIKey | HHFZRSLVPCGSGT-UHFFFAOYSA-N |
| SMILES | C=CCN(c1ccccc1)c1nc(Cl)nc(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: InChIKey of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is HHFZRSLVPCGSGT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 106912-96-3? |
| A: Chinese name of 106912-96-3 is 106912-96-3. |
| Q: What is the molecular weight of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: Molecular weight of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is 281.14. |
| Q: What is the English name of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: The English name of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine. |
| Q: What is the molecular formula of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: Molecular formula of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is C12H10Cl2N4. |
| Q: What is the SMILES notation of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: SMILES notation of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is C=CCN(c1ccccc1)c1nc(Cl)nc(Cl)n1. |
| Q: What is the CAS number of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine? |
| A: CAS number of 4,6-Dichloro-N-phenyl-N-2-propen-1-yl-1,3,5-triazin-2-amine is 106912-96-3. |