3-Nitro-4-[[2-(phenylthio)ethyl]amino]benzenesulfonyl azide structure
|
Common Name | 3-Nitro-4-[[2-(phenylthio)ethyl]amino]benzenesulfonyl azide | ||
|---|---|---|---|---|
| CAS Number | 1069135-23-4 | Molecular Weight | 379.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N5O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Nitro-4-[[2-(phenylthio)ethyl]amino]benzenesulfonyl azide |
|---|
| Molecular Formula | C14H13N5O4S2 |
|---|---|
| Molecular Weight | 379.4 |
| InChIKey | JOUBAVABKSFPHS-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(NCCSc2ccccc2)c([N+](=O)[O-])c1 |
|
Name: Inhibition of GST-tagged mouse Mcl-1 (152 to 309 residues)/FITC-labelled Bim (unknown...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5384359
|