4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide
Modify Date: 2026-07-07 18:39:23
4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide structure
|
Common Name | 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 106917-53-7 | Molecular Weight | 415.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl2F3N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl2F3N2O4S |
|---|---|
| Molecular Weight | 415.2 |
| InChIKey | HYOCOKLORFSRQR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)c(Cl)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Fungicidal activity against clubroot disease causing Plasmodiophora brassicae infeste...
Source: ChEMBL
Target: Plasmodiophora brassicae
External Id: CHEMBL3069872
|
|
Name: Fungicidal activity against clubroot disease causing Plasmodiophora brassicae infeste...
Source: ChEMBL
Target: Plasmodiophora brassicae
External Id: CHEMBL3069873
|
|
Name: Fungicidal activity against clubroot disease causing Plasmodiophora brassicae infeste...
Source: ChEMBL
Target: Plasmodiophora brassicae
External Id: CHEMBL3081878
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: InChIKey of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is HYOCOKLORFSRQR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 106917-53-7? |
| A: Chinese name of 106917-53-7 is 106917-53-7. |
| Q: What is the CAS number of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: CAS number of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is 106917-53-7. |
| Q: What is the English name of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: The English name of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide. |
| Q: What is the molecular weight of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: Molecular weight of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is 415.2. |
| Q: What is the SMILES notation of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: SMILES notation of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is O=[N+]([O-])c1ccc(NS(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)c(Cl)c1. |
| Q: What is the molecular formula of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide? |
| A: Molecular formula of 4-chloro-N-(2-chloro-4-nitrophenyl)-alpha,alpha,alpha-trifluoro-m-toluene sulfonamide is C13H7Cl2F3N2O4S. |