2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one
![2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one Structure](https://image.chemsrc.com/caspic/471/106924-06-5.png)
2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one structure
|
Common Name | 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 106924-06-5 | Molecular Weight | 334.32900 | |
| Density | 1.43g/cm3 | Boiling Point | 484.5ºC at 760 mmHg | |
| Molecular Formula | C18H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8ºC | |
Summary: 2-Methyl-3-[(2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl)methyl]quinazolin-4-one (CAS号：106924-06-5)，molecular formula C18H14N4O3，molecular weight 334.33. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 484.5ºC at 760 mmHg |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.32900 |
| Flash Point | 246.8ºC |
| Exact Mass | 334.10700 |
| PSA | 93.78000 |
| LogP | 1.19620 |
| Vapour Pressure | 1.53E-09mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | VNCBFDKDDHBHPW-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1Cc1nnc(-c2ccc(O)cc2)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~51%
2-methyl-3-[[2-... CAS#:106924-06-5 |
| Literature: Rao, A. Devender; Shankar, Ch. Ravi; Rao, A. Bhaskar; Reddy, V. Malla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 665 - 667 |
|
~%
2-methyl-3-[[2-... CAS#:106924-06-5 |
| Literature: Rao, A. Devender; Shankar, Ch. Ravi; Rao, A. Bhaskar; Reddy, V. Malla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 665 - 667 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: Molecular formula of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is C18H14N4O3. |
| Q: What is the LogP of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: LogP of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is 1.19620. |
| Q: What is the molecular weight of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: Molecular weight of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is 334.32900. |
| Q: What is the SMILES notation of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: SMILES notation of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is Cc1nc2ccccc2c(=O)n1Cc1nnc(-c2ccc(O)cc2)o1. |
| Q: What are the upstream materials of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: Related upstream materials(CAS) of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one: 16353-15-4;99-96-7;525-76-8. |
| Q: What is the English name of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: The English name of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one. |
| Q: What is the polar surface area (PSA) of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: Polar surface area (PSA) of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is 93.78000. |
| Q: What is the Chinese name of 106924-06-5? |
| A: Chinese name of 106924-06-5 is 106924-06-5. |
| Q: What is the InChIKey of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: InChIKey of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is VNCBFDKDDHBHPW-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one? |
| A: Boiling point of 2-methyl-3-[[2-(4-oxocyclohexa-2,5-dien-1-ylidene)-3H-1,3,4-oxadiazol-5-yl]methyl]quinazolin-4-one is 484.5ºC at 760 mmHg. |