3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one
![3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one Structure](https://image.chemsrc.com/caspic/433/106924-07-6.png)
3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one structure
|
Common Name | 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 106924-07-6 | Molecular Weight | 332.35600 | |
| Density | 1.31g/cm3 | Boiling Point | 550.4ºC at 760mmHg | |
| Molecular Formula | C19H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.7ºC | |
Summary: 3-[(5-Benzyl-1,3,4-Oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one (CAS number: 106924-07-6), molecular formula C19H16N4O2, molecular weight 332.35600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 550.4ºC at 760mmHg |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.35600 |
| Flash Point | 286.7ºC |
| Exact Mass | 332.12700 |
| PSA | 73.81000 |
| LogP | 2.72700 |
| Vapour Pressure | 3.67E-12mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | IDJRUZZETUDDCQ-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1Cc1nnc(Cc2ccccc2)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
3-[(5-benzyl-1,... CAS#:106924-07-6 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 25, p. 665 - 667 |
|
~%
3-[(5-benzyl-1,... CAS#:106924-07-6 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 25, p. 665 - 667 |
|
~%
3-[(5-benzyl-1,... CAS#:106924-07-6 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 25, p. 665 - 667 |
|
~%
3-[(5-benzyl-1,... CAS#:106924-07-6 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 25, p. 665 - 667 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: The English name of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one. |
| Q: What is the molecular formula of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: Molecular formula of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is C19H16N4O2. |
| Q: What is the boiling point of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: Boiling point of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is 550.4ºC at 760mmHg. |
| Q: What is the CAS number of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: CAS number of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is 106924-07-6. |
| Q: What is the SMILES notation of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: SMILES notation of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is Cc1nc2ccccc2c(=O)n1Cc1nnc(Cc2ccccc2)o1. |
| Q: What is the LogP of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: LogP of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is 2.72700. |
| Q: What are the upstream materials of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: Related upstream materials(CAS) of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one: 103-82-2;16353-15-4;525-76-8;50844-82-1. |
| Q: What is the polar surface area (PSA) of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: Polar surface area (PSA) of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is 73.81000. |
| Q: What is the InChIKey of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one? |
| A: InChIKey of 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-2-methylquinazolin-4-one is IDJRUZZETUDDCQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 106924-07-6? |
| A: Chinese name of 106924-07-6 is 106924-07-6. |