Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate
Modify Date: 2026-07-15 10:10:42
![Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate Structure](https://www.chemsrc.com/extcaspic/125/106928-49-8.png)
Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate structure
|
Common Name | Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 106928-49-8 | Molecular Weight | 263.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO4 |
|---|---|
| Molecular Weight | 263.29 |
| InChIKey | RKNNPGXXWNQYKS-UHFFFAOYSA-N |
| SMILES | C=CCC(NC(=O)OCc1ccccc1)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: Molecular weight of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is 263.29. |
| Q: What is the CAS number of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: CAS number of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is 106928-49-8. |
| Q: What is the English name of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: The English name of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate. |
| Q: What is the Chinese name of 106928-49-8? |
| A: Chinese name of 106928-49-8 is 106928-49-8. |
| Q: What is the SMILES notation of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: SMILES notation of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is C=CCC(NC(=O)OCc1ccccc1)C(=O)OC. |
| Q: What is the InChIKey of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: InChIKey of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is RKNNPGXXWNQYKS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate? |
| A: Molecular formula of Methyl 2-{[(benzyloxy)carbonyl]amino}pent-4-enoate is C14H17NO4. |