2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide structure
|
Common Name | 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 106929-06-0 | Molecular Weight | 376.20300 | |
| Density | 1.574g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H18BrN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Bromo-N-[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]acetamide, CAS number 106929-06-0, molecular formula C13H18BrN3O5, molecular weight 376.20300, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.574g/cm3 |
|---|---|
| Molecular Formula | C13H18BrN3O5 |
| Molecular Weight | 376.20300 |
| Exact Mass | 375.04300 |
| PSA | 117.17000 |
| LogP | 0.51110 |
| Index of Refraction | 1.58 |
| InChIKey | IUUVJEJFCQLKPN-IQJOONFLSA-N |
| SMILES | CCc1cn(C2CC(O)C(CNC(=O)CBr)O2)c(=O)[nH]c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
2-bromo-N-[[(2R... CAS#:106929-06-0 |
| Literature: Elliott; Pruett; Brockman; Montgomery Journal of Medicinal Chemistry, 1987 , vol. 30, # 5 p. 927 - 930 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 106929-06-0? |
| A: Chinese name of 106929-06-0 is 106929-06-0. |
| Q: What is the LogP of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: LogP of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is 0.51110. |
| Q: What is the molecular weight of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: Molecular weight of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is 376.20300. |
| Q: What are the upstream materials of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: Related upstream materials(CAS) of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide: 19199-82-7;90760-95-5. |
| Q: What is the molecular formula of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: Molecular formula of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is C13H18BrN3O5. |
| Q: What is the SMILES notation of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: SMILES notation of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is CCc1cn(C2CC(O)C(CNC(=O)CBr)O2)c(=O)[nH]c1=O. |
| Q: What is the CAS number of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: CAS number of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is 106929-06-0. |
| Q: What is the polar surface area (PSA) of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: Polar surface area (PSA) of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is 117.17000. |
| Q: What is the English name of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: The English name of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide. |
| Q: What is the InChIKey of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide? |
| A: InChIKey of 2-bromo-N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]acetamide is IUUVJEJFCQLKPN-IQJOONFLSA-N. |