(diethoxyphosphoryl)methyl triflate
(diethoxyphosphoryl)methyl triflate structure
|
Common Name | (diethoxyphosphoryl)methyl triflate | ||
|---|---|---|---|---|
| CAS Number | 106938-62-9 | Molecular Weight | 300.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12F3O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (diethoxyphosphoryl)methyl triflate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H12F3O6PS |
|---|---|
| Molecular Weight | 300.19000 |
| Exact Mass | 300.00400 |
| PSA | 97.09000 |
| LogP | 3.15700 |
| InChIKey | BNKDGTGYTVFGBY-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(COS(=O)(=O)C(F)(F)F)OCC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
![(R)-9-[2-(DIETHYLPHOSPHONOMETHOXY)PROPYL]ADENINE structure](https://image.chemsrc.com/caspic/388/180587-75-1.png)
CAS#:180587-75-1
CAS#:762-04-9
CAS#:54553-21-8
CAS#:1066-51-9
CAS#:20408-33-7![1-[ethoxy(fluoromethyl)phosphoryl]oxyethane structure](https://image.chemsrc.com/caspic/456/96857-55-5.png)
CAS#:96857-55-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| trifluoromethanesulfonic acid-(diethoxyphosphinyl)-methyl ester |
| .trifluoromethanesulfonic acid (diethoxyphosphoryl)methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (diethoxyphosphoryl)methyl triflate? |
| A: LogP of (diethoxyphosphoryl)methyl triflate is 3.15700. |
| Q: What is the English name of (diethoxyphosphoryl)methyl triflate? |
| A: The English name of (diethoxyphosphoryl)methyl triflate is (diethoxyphosphoryl)methyl triflate. |
| Q: What is the molecular weight of (diethoxyphosphoryl)methyl triflate? |
| A: Molecular weight of (diethoxyphosphoryl)methyl triflate is 300.19000. |
| Q: What is the SMILES notation of (diethoxyphosphoryl)methyl triflate? |
| A: SMILES notation of (diethoxyphosphoryl)methyl triflate is CCOP(=O)(COS(=O)(=O)C(F)(F)F)OCC. |
| Q: What is the molecular formula of (diethoxyphosphoryl)methyl triflate? |
| A: Molecular formula of (diethoxyphosphoryl)methyl triflate is C6H12F3O6PS. |
| Q: What is the CAS number of (diethoxyphosphoryl)methyl triflate? |
| A: CAS number of (diethoxyphosphoryl)methyl triflate is 106938-62-9. |
| Q: What English synonyms does (diethoxyphosphoryl)methyl triflate have? |
| A: English synonyms of (diethoxyphosphoryl)methyl triflate: trifluoromethanesulfonic acid-(diethoxyphosphinyl)-methyl ester, .trifluoromethanesulfonic acid (diethoxyphosphoryl)methyl ester. |
| Q: What are the downstream products of (diethoxyphosphoryl)methyl triflate? |
| A: Related downstream products(CAS) of (diethoxyphosphoryl)methyl triflate: 180587-75-1;762-04-9;54553-21-8;1066-51-9;20408-33-7;96857-55-5. |
| Q: What is the polar surface area (PSA) of (diethoxyphosphoryl)methyl triflate? |
| A: Polar surface area (PSA) of (diethoxyphosphoryl)methyl triflate is 97.09000. |
| Q: What is the InChIKey of (diethoxyphosphoryl)methyl triflate? |
| A: InChIKey of (diethoxyphosphoryl)methyl triflate is BNKDGTGYTVFGBY-UHFFFAOYSA-N. |