Phenyl 2-formylbenzenesulfonate
Modify Date: 2026-07-15 10:38:33
Phenyl 2-formylbenzenesulfonate structure
|
Common Name | Phenyl 2-formylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 106939-91-7 | Molecular Weight | 262.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenyl 2-formylbenzenesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10O4S |
|---|---|
| Molecular Weight | 262.28 |
| InChIKey | ZLENFEOPCCFAEB-UHFFFAOYSA-N |
| SMILES | O=Cc1ccccc1S(=O)(=O)Oc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Phenyl 2-formylbenzenesulfonate? |
| A: Molecular weight of Phenyl 2-formylbenzenesulfonate is 262.28. |
| Q: What is the English name of Phenyl 2-formylbenzenesulfonate? |
| A: The English name of Phenyl 2-formylbenzenesulfonate is Phenyl 2-formylbenzenesulfonate. |
| Q: What is the Chinese name of 106939-91-7? |
| A: Chinese name of 106939-91-7 is 106939-91-7. |
| Q: What is the InChIKey of Phenyl 2-formylbenzenesulfonate? |
| A: InChIKey of Phenyl 2-formylbenzenesulfonate is ZLENFEOPCCFAEB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Phenyl 2-formylbenzenesulfonate? |
| A: Molecular formula of Phenyl 2-formylbenzenesulfonate is C13H10O4S. |
| Q: What is the SMILES notation of Phenyl 2-formylbenzenesulfonate? |
| A: SMILES notation of Phenyl 2-formylbenzenesulfonate is O=Cc1ccccc1S(=O)(=O)Oc1ccccc1. |
| Q: What is the CAS number of Phenyl 2-formylbenzenesulfonate? |
| A: CAS number of Phenyl 2-formylbenzenesulfonate is 106939-91-7. |