4-Bromophenyl 2-formylbenzenesulfonate
Modify Date: 2025-10-23 10:14:37
4-Bromophenyl 2-formylbenzenesulfonate structure
|
Common Name | 4-Bromophenyl 2-formylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 106939-92-8 | Molecular Weight | 341.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromophenyl 2-formylbenzenesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9BrO4S |
|---|---|
| Molecular Weight | 341.18 |
| InChIKey | FTXMYTAMCQFJPV-UHFFFAOYSA-N |
| SMILES | O=Cc1ccccc1S(=O)(=O)Oc1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: Molecular weight of 4-Bromophenyl 2-formylbenzenesulfonate is 341.18. |
| Q: What is the SMILES notation of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: SMILES notation of 4-Bromophenyl 2-formylbenzenesulfonate is O=Cc1ccccc1S(=O)(=O)Oc1ccc(Br)cc1. |
| Q: What is the English name of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: The English name of 4-Bromophenyl 2-formylbenzenesulfonate is 4-Bromophenyl 2-formylbenzenesulfonate. |
| Q: What is the InChIKey of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: InChIKey of 4-Bromophenyl 2-formylbenzenesulfonate is FTXMYTAMCQFJPV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: CAS number of 4-Bromophenyl 2-formylbenzenesulfonate is 106939-92-8. |
| Q: What is the Chinese name of 106939-92-8? |
| A: Chinese name of 106939-92-8 is 106939-92-8. |
| Q: What is the molecular formula of 4-Bromophenyl 2-formylbenzenesulfonate? |
| A: Molecular formula of 4-Bromophenyl 2-formylbenzenesulfonate is C13H9BrO4S. |