4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide
![4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide Structure](https://image.chemsrc.com/caspic/420/106942-50-1.png)
4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide structure
|
Common Name | 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide | ||
|---|---|---|---|---|
| CAS Number | 106942-50-1 | Molecular Weight | 360.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-Methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium dibromide (CAS号：106942-50-1)，molecular formula：C13H16Br2N2，molecular weight：360.08800。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16Br2N2 |
|---|---|
| Molecular Weight | 360.08800 |
| Exact Mass | 357.96800 |
| PSA | 7.76000 |
| InChIKey | YHJQEOAQVGEECJ-UHFFFAOYSA-L |
| SMILES | Cc1cc[n+](C[n+]2ccc(C)cc2)cc1.[Br-].[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
4-methyl-1-[(4-... CAS#:106942-50-1 |
| Literature: Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, , vol. 37, # 3 p. 206 - 211 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-methylenedipicolinium bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide have? |
| A: English synonyms of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide: N,N'-methylenedipicolinium bromide. |
| Q: What is the SMILES notation of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: SMILES notation of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is Cc1cc[n+](C[n+]2ccc(C)cc2)cc1.[Br-].[Br-]. |
| Q: What are the upstream materials of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: Related upstream materials(CAS) of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide: 108-89-4;74-95-3. |
| Q: What is the CAS number of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: CAS number of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is 106942-50-1. |
| Q: What is the English name of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: The English name of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide. |
| Q: What is the molecular formula of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: Molecular formula of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is C13H16Br2N2. |
| Q: What is the molecular weight of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: Molecular weight of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is 360.08800. |
| Q: What is the polar surface area (PSA) of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: Polar surface area (PSA) of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is 7.76000. |
| Q: What is the Chinese name of 106942-50-1? |
| A: Chinese name of 106942-50-1 is 106942-50-1. |
| Q: What is the InChIKey of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide? |
| A: InChIKey of 4-methyl-1-[(4-methylpyridin-1-ium-1-yl)methyl]pyridin-1-ium,dibromide is YHJQEOAQVGEECJ-UHFFFAOYSA-L. |