O-ethyl 2-oxochromene-3-carbothioate
Modify Date: 2025-09-30 19:56:08
O-ethyl 2-oxochromene-3-carbothioate structure
|
Common Name | O-ethyl 2-oxochromene-3-carbothioate | ||
|---|---|---|---|---|
| CAS Number | 106944-55-2 | Molecular Weight | 234.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-ethyl 2-oxochromene-3-carbothioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10O3S |
|---|---|
| Molecular Weight | 234.27 |
| InChIKey | OPRJOWZGHLICMO-UHFFFAOYSA-N |
| SMILES | CCOC(=S)c1cc2ccccc2oc1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of O-ethyl 2-oxochromene-3-carbothioate? |
| A: SMILES notation of O-ethyl 2-oxochromene-3-carbothioate is CCOC(=S)c1cc2ccccc2oc1=O. |
| Q: What is the Chinese name of 106944-55-2? |
| A: Chinese name of 106944-55-2 is 106944-55-2. |
| Q: What is the InChIKey of O-ethyl 2-oxochromene-3-carbothioate? |
| A: InChIKey of O-ethyl 2-oxochromene-3-carbothioate is OPRJOWZGHLICMO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of O-ethyl 2-oxochromene-3-carbothioate? |
| A: Molecular formula of O-ethyl 2-oxochromene-3-carbothioate is C12H10O3S. |
| Q: What is the molecular weight of O-ethyl 2-oxochromene-3-carbothioate? |
| A: Molecular weight of O-ethyl 2-oxochromene-3-carbothioate is 234.27. |
| Q: What is the English name of O-ethyl 2-oxochromene-3-carbothioate? |
| A: The English name of O-ethyl 2-oxochromene-3-carbothioate is O-ethyl 2-oxochromene-3-carbothioate. |
| Q: What is the CAS number of O-ethyl 2-oxochromene-3-carbothioate? |
| A: CAS number of O-ethyl 2-oxochromene-3-carbothioate is 106944-55-2. |