O-Torsemide
Modify Date: 2025-11-06 09:18:14
O-Torsemide structure
|
Common Name | O-Torsemide | ||
|---|---|---|---|---|
| CAS Number | 106944-62-1 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-Torsemide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20N4O3S |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | QZCPTFXLYNBKGU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1Nc1ccncc1S(=O)(=O)NC(=O)NC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of O-Torsemide? |
| A: Molecular formula of O-Torsemide is C16H20N4O3S. |
| Q: What is the Chinese name of 106944-62-1? |
| A: Chinese name of 106944-62-1 is 106944-62-1. |
| Q: What is the SMILES notation of O-Torsemide? |
| A: SMILES notation of O-Torsemide is Cc1ccccc1Nc1ccncc1S(=O)(=O)NC(=O)NC(C)C. |
| Q: What is the CAS number of O-Torsemide? |
| A: CAS number of O-Torsemide is 106944-62-1. |
| Q: What is the molecular weight of O-Torsemide? |
| A: Molecular weight of O-Torsemide is 348.4. |
| Q: What is the English name of O-Torsemide? |
| A: The English name of O-Torsemide is O-Torsemide. |
| Q: What is the InChIKey of O-Torsemide? |
| A: InChIKey of O-Torsemide is QZCPTFXLYNBKGU-UHFFFAOYSA-N. |