(Adamantan-1-yl)methyl sulfamate
Modify Date: 2026-08-27 00:46:22
(Adamantan-1-yl)methyl sulfamate structure
|
Common Name | (Adamantan-1-yl)methyl sulfamate | ||
|---|---|---|---|---|
| CAS Number | 106946-96-7 | Molecular Weight | 245.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Adamantan-1-yl)methyl sulfamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19NO3S |
|---|---|
| Molecular Weight | 245.34 |
| InChIKey | WQYVONSVMMUQTA-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)OCC12CC3CC(CC(C3)C1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (Adamantan-1-yl)methyl sulfamate? |
| A: Molecular formula of (Adamantan-1-yl)methyl sulfamate is C11H19NO3S. |
| Q: What is the molecular weight of (Adamantan-1-yl)methyl sulfamate? |
| A: Molecular weight of (Adamantan-1-yl)methyl sulfamate is 245.34. |
| Q: What is the SMILES notation of (Adamantan-1-yl)methyl sulfamate? |
| A: SMILES notation of (Adamantan-1-yl)methyl sulfamate is NS(=O)(=O)OCC12CC3CC(CC(C3)C1)C2. |
| Q: What is the CAS number of (Adamantan-1-yl)methyl sulfamate? |
| A: CAS number of (Adamantan-1-yl)methyl sulfamate is 106946-96-7. |
| Q: What is the Chinese name of 106946-96-7? |
| A: Chinese name of 106946-96-7 is 106946-96-7. |
| Q: What is the English name of (Adamantan-1-yl)methyl sulfamate? |
| A: The English name of (Adamantan-1-yl)methyl sulfamate is (Adamantan-1-yl)methyl sulfamate. |
| Q: What is the InChIKey of (Adamantan-1-yl)methyl sulfamate? |
| A: InChIKey of (Adamantan-1-yl)methyl sulfamate is WQYVONSVMMUQTA-UHFFFAOYSA-N. |