(hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone
Modify Date: 2026-07-09 19:04:55
![(hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone Structure](https://www.chemsrc.com/extcaspic/496/1069489-50-4.png)
(hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone structure
|
Common Name | (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1069489-50-4 | Molecular Weight | 250.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2OS |
|---|---|
| Molecular Weight | 250.36 |
| InChIKey | ZJQHKXLSJJYXJT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccsc1)N1CCCN2CCCC2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: Molecular formula of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is C13H18N2OS. |
| Q: What is the CAS number of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: CAS number of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is 1069489-50-4. |
| Q: What is the Chinese name of 1069489-50-4? |
| A: Chinese name of 1069489-50-4 is 1069489-50-4. |
| Q: What is the molecular weight of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: Molecular weight of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is 250.36. |
| Q: What is the SMILES notation of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: SMILES notation of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is O=C(c1ccsc1)N1CCCN2CCCC2C1. |
| Q: What is the InChIKey of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: InChIKey of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is ZJQHKXLSJJYXJT-UHFFFAOYSA-N. |
| Q: What is the English name of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone? |
| A: The English name of (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone is (hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-2(3H)-yl)(thiophen-3-yl)methanone. |