2,3,7-trimethylchromen-4-one
2,3,7-trimethylchromen-4-one structure
|
Common Name | 2,3,7-trimethylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 106949-32-0 | Molecular Weight | 188.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,3,7-trimethylchromen-4-one, Chinese name 2,3,7-三甲基香豆素-4-酮, CAS number 106949-32-0, molecular formula C12H12O2, molecular weight 188.22200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,7-trimethylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12O2 |
|---|---|
| Molecular Weight | 188.22200 |
| Exact Mass | 188.08400 |
| PSA | 30.21000 |
| LogP | 2.71820 |
| InChIKey | ZUFWUUODOHMEON-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(=O)c(C)c(C)oc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~59%
2,3,7-trimethyl... CAS#:106949-32-0 |
| Literature: Nath; Ghosh; Venkateswaran Journal of Organic Chemistry, 1992 , vol. 57, # 5 p. 1467 - 1472 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,7-trimethylchromone |
| 2,3,7-Trimethyl-chromen-4-on |
| 2,3,7-trimethyl-chromen-4-one |
| 4H-1-Benzopyran-4-one,2,3,7-trimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,3,7-trimethylchromen-4-one? |
| A: LogP of 2,3,7-trimethylchromen-4-one is 2.71820. |
| Q: What is the InChIKey of 2,3,7-trimethylchromen-4-one? |
| A: InChIKey of 2,3,7-trimethylchromen-4-one is ZUFWUUODOHMEON-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,3,7-trimethylchromen-4-one have? |
| A: English synonyms of 2,3,7-trimethylchromen-4-one: 2,3,7-trimethylchromone, 2,3,7-Trimethyl-chromen-4-on, 2,3,7-trimethyl-chromen-4-one, 4H-1-Benzopyran-4-one,2,3,7-trimethyl. |
| Q: What is the molecular formula of 2,3,7-trimethylchromen-4-one? |
| A: Molecular formula of 2,3,7-trimethylchromen-4-one is C12H12O2. |
| Q: What is the English name of 2,3,7-trimethylchromen-4-one? |
| A: The English name of 2,3,7-trimethylchromen-4-one is 2,3,7-trimethylchromen-4-one. |
| Q: What is the SMILES notation of 2,3,7-trimethylchromen-4-one? |
| A: SMILES notation of 2,3,7-trimethylchromen-4-one is Cc1ccc2c(=O)c(C)c(C)oc2c1. |
| Q: What is the molecular weight of 2,3,7-trimethylchromen-4-one? |
| A: Molecular weight of 2,3,7-trimethylchromen-4-one is 188.22200. |
| Q: What is the CAS number of 2,3,7-trimethylchromen-4-one? |
| A: CAS number of 2,3,7-trimethylchromen-4-one is 106949-32-0. |
| Q: What is the polar surface area (PSA) of 2,3,7-trimethylchromen-4-one? |
| A: Polar surface area (PSA) of 2,3,7-trimethylchromen-4-one is 30.21000. |
| Q: What is the Chinese name of 106949-32-0? |
| A: Chinese name of 106949-32-0 is 106949-32-0. |