6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]
Modify Date: 2025-09-14 12:14:32
![6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] Structure](https://www.chemsrc.com/extcaspic/361/106960-80-9.png)
6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] structure
|
Common Name | 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 106960-80-9 | Molecular Weight | 435.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H15BrN2O3 |
|---|---|
| Molecular Weight | 435.3 |
| InChIKey | SWZGOFBPZGYXEN-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Nc2cc(Br)c3noc4c3c2C(=O)c2ccccc2-4)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 106960-80-9? |
| A: Chinese name of 106960-80-9 is 106960-80-9. |
| Q: What is the InChIKey of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: InChIKey of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is SWZGOFBPZGYXEN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: Molecular formula of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is C22H15BrN2O3. |
| Q: What is the molecular weight of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: Molecular weight of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is 435.3. |
| Q: What is the SMILES notation of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: SMILES notation of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is CCOc1ccc(Nc2cc(Br)c3noc4c3c2C(=O)c2ccccc2-4)cc1. |
| Q: What is the CAS number of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: CAS number of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is 106960-80-9. |
| Q: What is the English name of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]? |
| A: The English name of 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino] is 6H-Anthra[1,9-cd]isoxazol-6-one, 3-bromo-5-[(4-ethoxyphenyl)amino]. |