methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate
Modify Date: 2025-11-05 22:04:25
![methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate Structure](https://www.chemsrc.com/extcaspic/100/1069656-25-2.png)
methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate structure
|
Common Name | methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1069656-25-2 | Molecular Weight | 377.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H27NO3 |
|---|---|
| Molecular Weight | 377.5 |
| InChIKey | YVYBDJXQDCTENF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(C(=O)CC2c3ccccc3CCc3ccccc32)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: The English name of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate. |
| Q: What is the molecular formula of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: Molecular formula of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is C24H27NO3. |
| Q: What is the Chinese name of 1069656-25-2? |
| A: Chinese name of 1069656-25-2 is 1069656-25-2. |
| Q: What is the SMILES notation of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: SMILES notation of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is COC(=O)C1CCN(C(=O)CC2c3ccccc3CCc3ccccc32)CC1. |
| Q: What is the CAS number of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: CAS number of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is 1069656-25-2. |
| Q: What is the InChIKey of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: InChIKey of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is YVYBDJXQDCTENF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate? |
| A: Molecular weight of methyl 1-(10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ylacetyl)-4-piperidinecarboxylate is 377.5. |