15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene
Modify Date: 2025-09-25 11:00:59
![15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene Structure](https://www.chemsrc.com/extcaspic/133/106967-43-5.png)
15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene structure
|
Common Name | 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene | ||
|---|---|---|---|---|
| CAS Number | 106967-43-5 | Molecular Weight | 313.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21BrN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21BrN4 |
|---|---|
| Molecular Weight | 313.24 |
| InChIKey | KXEVVYXQVCHYTF-UHFFFAOYSA-N |
| SMILES | Brc1cc2nc(c1)CNCCCNCCCNC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: The English name of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene. |
| Q: What is the SMILES notation of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: SMILES notation of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is Brc1cc2nc(c1)CNCCCNCCCNC2. |
| Q: What is the CAS number of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: CAS number of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is 106967-43-5. |
| Q: What is the Chinese name of 106967-43-5? |
| A: Chinese name of 106967-43-5 is 106967-43-5. |
| Q: What is the molecular formula of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: Molecular formula of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is C13H21BrN4. |
| Q: What is the molecular weight of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: Molecular weight of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is 313.24. |
| Q: What is the InChIKey of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene? |
| A: InChIKey of 15-Bromo-3,7,11,17-tetraazabicyclo[11.3.1]heptadeca-1(17),13,15-triene is KXEVVYXQVCHYTF-UHFFFAOYSA-N. |