8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester
Modify Date: 2026-07-30 17:28:33
8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester structure
|
Common Name | 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 106971-64-6 | Molecular Weight | 350.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H30O5 |
|---|---|
| Molecular Weight | 350.4 |
| InChIKey | YAWHGFHPZRXYRV-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCCCCCCCC(=O)OC)ccc(C(C)=O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: Molecular weight of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is 350.4. |
| Q: What is the Chinese name of 106971-64-6? |
| A: Chinese name of 106971-64-6 is 106971-64-6. |
| Q: What is the SMILES notation of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: SMILES notation of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is CCCc1c(OCCCCCCCC(=O)OC)ccc(C(C)=O)c1O. |
| Q: What is the molecular formula of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: Molecular formula of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is C20H30O5. |
| Q: What is the InChIKey of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: InChIKey of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is YAWHGFHPZRXYRV-UHFFFAOYSA-N. |
| Q: What is the English name of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: The English name of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester. |
| Q: What is the CAS number of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester? |
| A: CAS number of 8-(4-Acetyl-3-hydroxy-2-propylphenoxy)octanoic acid methyl ester is 106971-64-6. |