Nomifensine hydrochloride, (R)
Modify Date: 2025-09-02 12:41:26
Nomifensine hydrochloride, (R) structure
|
Common Name | Nomifensine hydrochloride, (R) | ||
|---|---|---|---|---|
| CAS Number | 106976-99-2 | Molecular Weight | 274.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Nomifensine hydrochloride, (R) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19ClN2 |
|---|---|
| Molecular Weight | 274.79 |
| InChIKey | QVRVDOKQQXBOLD-PFEQFJNWSA-N |
| SMILES | CN1Cc2c(N)cccc2C(c2ccccc2)C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Nomifensine hydrochloride, (R)? |
| A: Molecular weight of Nomifensine hydrochloride, (R) is 274.79. |
| Q: What is the InChIKey of Nomifensine hydrochloride, (R)? |
| A: InChIKey of Nomifensine hydrochloride, (R) is QVRVDOKQQXBOLD-PFEQFJNWSA-N. |
| Q: What is the Chinese name of 106976-99-2? |
| A: Chinese name of 106976-99-2 is 106976-99-2. |
| Q: What is the molecular formula of Nomifensine hydrochloride, (R)? |
| A: Molecular formula of Nomifensine hydrochloride, (R) is C16H19ClN2. |
| Q: What is the SMILES notation of Nomifensine hydrochloride, (R)? |
| A: SMILES notation of Nomifensine hydrochloride, (R) is CN1Cc2c(N)cccc2C(c2ccccc2)C1.Cl. |
| Q: What is the CAS number of Nomifensine hydrochloride, (R)? |
| A: CAS number of Nomifensine hydrochloride, (R) is 106976-99-2. |
| Q: What is the English name of Nomifensine hydrochloride, (R)? |
| A: The English name of Nomifensine hydrochloride, (R) is Nomifensine hydrochloride, (R). |