2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid
Modify Date: 2025-10-16 13:40:42
![2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid Structure](https://www.chemsrc.com/extcaspic/424/106981-13-9.png)
2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid structure
|
Common Name | 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid | ||
|---|---|---|---|---|
| CAS Number | 106981-13-9 | Molecular Weight | 216.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4N2O3S2 |
|---|---|
| Molecular Weight | 216.2 |
| InChIKey | ALYPFBURUHFLNU-UHFFFAOYSA-N |
| SMILES | N#Cc1c(SCC(=O)O)s[nH]c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: InChIKey of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is ALYPFBURUHFLNU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: SMILES notation of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is N#Cc1c(SCC(=O)O)s[nH]c1=O. |
| Q: What is the CAS number of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: CAS number of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is 106981-13-9. |
| Q: What is the molecular weight of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: Molecular weight of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is 216.2. |
| Q: What is the molecular formula of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: Molecular formula of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is C6H4N2O3S2. |
| Q: What is the English name of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid? |
| A: The English name of 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid is 2-[(4-Cyano-3-hydroxy-1,2-thiazol-5-yl)sulfanyl]aceticacid. |
| Q: What is the Chinese name of 106981-13-9? |
| A: Chinese name of 106981-13-9 is 106981-13-9. |