Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate
Modify Date: 2026-06-30 17:43:39
![Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/108/106986-59-8.png)
Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate structure
|
Common Name | Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 106986-59-8 | Molecular Weight | 270.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H18O3 |
|---|---|
| Molecular Weight | 270.32 |
| InChIKey | MTQVZGPXRVAUMK-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccc(-c2ccc(O)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: CAS number of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is 106986-59-8. |
| Q: What is the molecular formula of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: Molecular formula of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is C17H18O3. |
| Q: What is the Chinese name of 106986-59-8? |
| A: Chinese name of 106986-59-8 is 106986-59-8. |
| Q: What is the molecular weight of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: Molecular weight of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is 270.32. |
| Q: What is the SMILES notation of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: SMILES notation of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is CCCCOC(=O)c1ccc(-c2ccc(O)cc2)cc1. |
| Q: What is the English name of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: The English name of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate. |
| Q: What is the InChIKey of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate? |
| A: InChIKey of Butyl 4'-hydroxy[1,1'-biphenyl]-4-carboxylate is MTQVZGPXRVAUMK-UHFFFAOYSA-N. |