1-tert-butyl 2-methyl (2S)-azetidine-1,2-dicarboxylate structure
|
Common Name | 1-tert-butyl 2-methyl (2S)-azetidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 107020-12-2 | Molecular Weight | 215.246 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 269.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.5±25.4 °C | |
| Name | 1-O-tert-butyl 2-O-methyl (2S)-azetidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.0±33.0 °C at 760 mmHg |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.246 |
| Flash Point | 116.5±25.4 °C |
| Exact Mass | 215.115753 |
| PSA | 55.84000 |
| LogP | 0.76 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | FGWUDHZVEBFGKS-ZETCQYMHSA-N |
| SMILES | COC(=O)C1CCN1C(=O)OC(C)(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Azetidinedicarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester, (2S)- |
| N-Boc azetidine-2-carboxylate methyl ester |
| methyl N-tert-butyloxycarbonyl-L-azetidine-2-carboxylate |
| 2-Methyl 1-(2-methyl-2-propanyl) (2S)-1,2-azetidinedicarboxylate |
| 1-tert-butyl 2-methyl (2S)-azetidine-1,2-dicarboxylate |