2-(3-Methoxyphenyl)-8-methylquinoline-4-carboxylic acid structure
|
Common Name | 2-(3-Methoxyphenyl)-8-methylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 107027-41-8 | Molecular Weight | 293.31700 | |
| Density | 1.248g/cm3 | Boiling Point | 491.6ºC at 760 mmHg | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 2-(3-Methoxyphenyl)-8-methylquinoline-4-carboxylic acid |
|---|
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 491.6ºC at 760 mmHg |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.31700 |
| Flash Point | 251.1ºC |
| Exact Mass | 293.10500 |
| PSA | 59.42000 |
| LogP | 3.91700 |
| Vapour Pressure | 1.76E-10mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | FTBPGONXYWLYIQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cc(C(=O)O)c3cccc(C)c3n2)c1 |
| HS Code | 2933499090 |
|---|
|
~%
2-(3-Methoxyphe... CAS#:107027-41-8 |
| Literature: Atwell; Baguley; Denny Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 396 - 401 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |