2-(Bromomethyl)-alpha-(methoxymethylene)benzeneacetic acid methyl ester structure
|
Common Name | 2-(Bromomethyl)-alpha-(methoxymethylene)benzeneacetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 107048-59-9 | Molecular Weight | 285.13400 | |
| Density | 1.383 | Boiling Point | 383.487ºC at 760 mmHg | |
| Molecular Formula | C12H13BrO3 | Melting Point | 94ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoate |
|---|
| Density | 1.383 |
|---|---|
| Boiling Point | 383.487ºC at 760 mmHg |
| Melting Point | 94ºC |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.13400 |
| Exact Mass | 284.00500 |
| PSA | 35.53000 |
| LogP | 2.74180 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | MGUDGDSNHPKOLL-UHFFFAOYSA-N |
| SMILES | COC=C(C(=O)OC)c1ccccc1CBr |
| HS Code | 2918990090 |
|---|
|
~%
2-(Bromomethyl)... CAS#:107048-59-9 |
| Literature: Huazhong Normal University; Zhejiang Bosta Cropscience Co., Ltd. Patent: EP2301925 A1, 2011 ; |
|
~%
2-(Bromomethyl)... CAS#:107048-59-9 |
| Literature: Huazhong Normal University; Zhejiang Bosta Cropscience Co., Ltd. Patent: EP2301925 A1, 2011 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |