4-methoxy-3-(trifluoromethoxy)benzoyl chloride structure
|
Common Name | 4-methoxy-3-(trifluoromethoxy)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1070774-23-0 | Molecular Weight | 254.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxy-3-(trifluoromethoxy)benzoyl chloride |
|---|
| Molecular Formula | C9H6ClF3O3 |
|---|---|
| Molecular Weight | 254.59000 |
| Exact Mass | 253.99600 |
| PSA | 35.53000 |
| LogP | 2.97280 |
| InChIKey | HWYUFLOSGDZCMG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Cl)cc1OC(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |