6-(2-Methoxyphenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(2-Methoxyphenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 107151-39-3 | Molecular Weight | 236.26400 | |
| Density | 1.149g/cm3 | Boiling Point | 418.1ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
| Name | 6-(2-Methoxyphenyl)-6-oxohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 418.1ºC at 760 mmHg |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 159ºC |
| Exact Mass | 236.10500 |
| PSA | 63.60000 |
| LogP | 2.52290 |
| Vapour Pressure | 9.7E-08mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | JBMUVGPYRUXXDZ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)CCCCC(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
6-(2-Methoxyphe... CAS#:107151-39-3 |
| Literature: Journal of the Chemical Society, , p. 1586 |
|
~%
6-(2-Methoxyphe... CAS#:107151-39-3 |
| Literature: Chemische Berichte, , vol. 55, p. 3767 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-(2-Methoxy-phenyl)-6-oxo-hexansaeure |
| 6-(2-methoxy-phenyl)-6-oxo-hexanoic acid |