(2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride
Modify Date: 2025-11-05 21:43:08
(2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride structure
|
Common Name | (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1071592-08-9 | Molecular Weight | 309.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20ClNO3 |
|---|---|
| Molecular Weight | 309.79 |
| InChIKey | VAXMTYJIIVLKMJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(N)c2ccc(OC)cc2OC)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: Molecular weight of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is 309.79. |
| Q: What is the molecular formula of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: Molecular formula of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is C16H20ClNO3. |
| Q: What is the Chinese name of 1071592-08-9? |
| A: Chinese name of 1071592-08-9 is 1071592-08-9. |
| Q: What is the CAS number of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: CAS number of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is 1071592-08-9. |
| Q: What is the SMILES notation of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: SMILES notation of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is COc1ccc(C(N)c2ccc(OC)cc2OC)cc1.Cl. |
| Q: What is the InChIKey of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: InChIKey of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is VAXMTYJIIVLKMJ-UHFFFAOYSA-N. |
| Q: What is the English name of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride? |
| A: The English name of (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride is (2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanamine hydrochloride. |