Gevotroline structure
|
Common Name | Gevotroline | ||
|---|---|---|---|---|
| CAS Number | 107266-06-8 | Molecular Weight | 309.38100 | |
| Density | 1.227g/cm3 | Boiling Point | 498ºC at 760mmHg | |
| Molecular Formula | C19H20FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | 8-fluoro-2-(3-pyridin-3-ylpropyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 498ºC at 760mmHg |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.38100 |
| Flash Point | 255ºC |
| Exact Mass | 309.16400 |
| PSA | 31.92000 |
| LogP | 3.63080 |
| Vapour Pressure | 4.73E-10mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | RZXHTPCHKSYGIB-UHFFFAOYSA-N |
| SMILES | Fc1ccc2[nH]c3c(c2c1)CN(CCCc1cccnc1)CC3 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Gevotrolinum [INN-Latin] |
| GEVOTROLINE HYDROCHLORIDE |
| Gevotroline [INN] |
| 8-fluoro-2,3,4,5-tetrahydro-2-[3-(3-pyridinyl)propyl]1H-pyrido[4,3-b]indole |
| Gevotrolinum |
| Gevotrolina |
| GEVOTROLINE |