3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid structure
|
Common Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1072901-47-3 | Molecular Weight | 373.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H19NO4 |
|---|---|
| Molecular Weight | 373.40100 |
| Exact Mass | 373.13100 |
| PSA | 75.63000 |
| LogP | 5.12720 |
| InChIKey | PZBXPHGPGVUOMO-UHFFFAOYSA-N |
| SMILES | Cc1c(NC(=O)OCC2c3ccccc3-c3ccccc32)cccc1C(=O)O |
| HS Code | 2922499990 |
|---|
|
~78%
3-(9H-fluoren-9... CAS#:1072901-47-3 |
| Literature: Hourani, Rami; Zhang, Chen; Van Der Weegen, Rob; Ruiz, Luis; Li, Changyi; Keten, Sinan; Helms, Brett A.; Xu, Ting Journal of the American Chemical Society, 2011 , vol. 133, # 39 p. 15296 - 15299 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-(9-fluorenylmethyloxycarbonyl)amino-2-methylbenzoic acid |
| 3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-2-methylbenzoic acid |