4-[(4-tert-Butyl-2-methylphenoxy)methyl]phenylboronic acid structure
|
Common Name | 4-[(4-tert-Butyl-2-methylphenoxy)methyl]phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 1072951-67-7 | Molecular Weight | 298.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23BO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 4-[(4-tert-Butyl-2-methylphenoxy)methyl]phenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H23BO3 |
|---|---|
| Molecular Weight | 298.18400 |
| Exact Mass | 298.17400 |
| PSA | 49.69000 |
| LogP | 2.55130 |
| InChIKey | OPUGDQNAZFDADD-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCc1ccc(B(O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | UN 3335 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [4-[(4-tert-butyl-2-methylphenoxy)methyl]phenyl]boronic acid |
| (4-((4-(tert-Butyl)-2-methylphenoxy)methyl)phenyl)boronic acid |