1-Piperazinepropanamide, N-(3-aminophenyl)-4-(diphenylmethyl)- structure
|
Common Name | 1-Piperazinepropanamide, N-(3-aminophenyl)-4-(diphenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 107314-43-2 | Molecular Weight | 414.54300 | |
| Density | 1.191g/cm3 | Boiling Point | 632.2ºC at 760mmHg | |
| Molecular Formula | C26H30N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.1ºC | |
| Name | N-(3-aminophenyl)-3-(4-benzhydrylpiperazin-1-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 632.2ºC at 760mmHg |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.54300 |
| Flash Point | 336.1ºC |
| Exact Mass | 414.24200 |
| PSA | 65.09000 |
| LogP | 5.11110 |
| Vapour Pressure | 6.89E-16mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | ZMDLYGGNQZZZPT-UHFFFAOYSA-N |
| SMILES | Nc1cccc(NC(=O)CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| HS Code | 2933599090 |
|---|
|
~%
1-Piperazinepro... CAS#:107314-43-2 |
| Literature: RECORDATI S.A., CHEMICAL and PHARMACEUTICAL COMPANY Patent: EP207901 A1, 1987 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinepropanamide,N-(3-aminophenyl)-4-(diphenylmethyl) |
| N-(3-Aminophenyl)-4-(diphenylmethyl)-1-piperazinepropanamide |
| 3-(4-benzhydryl-1-piperazinyl)-N,3-aminophenylpropionamide |