PPC-NHS ester
Modify Date: 2025-08-24 13:17:25
PPC-NHS ester structure
|
Common Name | PPC-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 107348-47-0 | Molecular Weight | 327.39900 | |
| Density | 1.43g/cm3 | Boiling Point | 468.8ºC at 760mmHg | |
| Molecular Formula | C13H14N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.3ºC | |
Use of PPC-NHS esterPPC-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]butanoate |
|---|---|
| Synonym | More Synonyms |
| Description | PPC-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760mmHg |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 327.39900 |
| Flash Point | 237.3ºC |
| Exact Mass | 327.04700 |
| PSA | 131.35000 |
| LogP | 0.54770 |
| Vapour Pressure | 5.81E-09mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | VQZYZXLBKBUOHE-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)ON1C(=O)CCC1=O)SSc1ccccn1 |
| Storage condition | -20°C |
| MFCD28398150 |