3-pyrrol-1-yl-1-benzothiophene-2-carbohydrazide structure
|
Common Name | 3-pyrrol-1-yl-1-benzothiophene-2-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 107363-01-9 | Molecular Weight | 257.31100 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11N3OS | Melting Point | 129-132ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-pyrrol-1-yl-1-benzothiophene-2-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Melting Point | 129-132ºC |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.31100 |
| Exact Mass | 257.06200 |
| PSA | 88.29000 |
| LogP | 3.38670 |
| Index of Refraction | 1.734 |
| InChIKey | OLGOTFKDOTUCRV-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1sc2ccccc2c1-n1cccc1 |
| HS Code | 2934999090 |
|---|
|
~83%
3-pyrrol-1-yl-1... CAS#:107363-01-9 |
| Literature: El-Kashef; Rault; Lancelot; Robba Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 1 p. 161 - 167 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1-pyrrolyl)-2-hydrazinocarbonyl[1]benzothiophene |
| 3-(1H-pyrrol-1-yl)-1-benzothiophene-2-carbohydrazide |
| Benzo[b]thiophene-2-carboxylicacid,3-(1H-pyrrol-1-yl)-,hydrazide |
| pyrrolylbenzothiophenecarbohydrazide |