4-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoic acid structure
|
Common Name | 4-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 107430-51-3 | Molecular Weight | 358.47300 | |
| Density | 1.102g/cm3 | Boiling Point | 526.5ºC at 760mmHg | |
| Molecular Formula | C25H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.9ºC | |
| Name | 4-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 526.5ºC at 760mmHg |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.47300 |
| Flash Point | 241.9ºC |
| Exact Mass | 358.19300 |
| PSA | 37.30000 |
| LogP | 6.55400 |
| Vapour Pressure | 6.5E-12mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | KBUHKLGVLUHYJL-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C)(C)c2cc3cc(-c4ccc(C(=O)O)cc4)ccc3cc21 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| SR 3961 |
| 4-Ttab |
| CD-367 |